Online Database of Chemicals from Around the World
|
CAS#: 66941-07-9 Product: 1,3-Dimethyl-5-(1-Methylbutyl)Barbituric Acid No suppilers available for the product. |
| Name | 1,3-Dimethyl-5-(1-Methylbutyl)Barbituric Acid |
|---|---|
| Synonyms | 1,3-Dimethyl-5-(1-Methylbutyl)Hexahydropyrimidine-2,4,6-Trione; 1,3-Dimethyl-5-(1-Methylbutyl)Barbituric Acid; 4-24-00-01930 (Beilstein Handbook Reference) |
| Molecular Structure |  |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.27 |
| CAS Registry Number | 66941-07-9 |
| SMILES | C(C(C1C(N(C(N(C1=O)C)=O)C)=O)C)CC |
| InChI | 1S/C11H18N2O3/c1-5-6-7(2)8-9(14)12(3)11(16)13(4)10(8)15/h7-8H,5-6H2,1-4H3 |
| InChIKey | XOADURCWFNUIPK-UHFFFAOYSA-N |
| Density | 1.114g/cm3 (Cal.) |
|---|---|
| Boiling point | 298.819°C at 760 mmHg (Cal.) |
| Flash point | 114.598°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-Dimethyl-5-(1-Methylbutyl)Barbituric Acid |