|
CAS#: 66968-17-0 Product: Hexahydro-5,5,7-Trimethyl-2H-Azepin-2-One No suppilers available for the product. |
| Name | Hexahydro-5,5,7-Trimethyl-2H-Azepin-2-One |
|---|---|
| Synonyms | 5,5,7-Trimethyl-2-Azepanone Hydrochloride; 2H-Azepin-2-One, Hexahydro-5,5,7-Trimethyl-, Hydrochloride; Hexahydro-5,5,7-Trimethyl-2H-Azepin-2-One Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C9H18ClNO |
| Molecular Weight | 191.70 |
| CAS Registry Number | 66968-17-0 |
| SMILES | [H+].CC1(CC(NC(=O)CC1)C)C.[Cl-] |
| InChI | 1S/C9H17NO.ClH/c1-7-6-9(2,3)5-4-8(11)10-7;/h7H,4-6H2,1-3H3,(H,10,11);1H |
| InChIKey | ACRFJCHVXOIHLJ-UHFFFAOYSA-N |
| Boiling point | 271.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 155.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Hexahydro-5,5,7-Trimethyl-2H-Azepin-2-One |