|
CAS#: 670-24-6 Product: (S)-1,2,3,4,5,6,7,8-Octahydro-2,5,5-Trimethyl-2-Naphthol No suppilers available for the product. |
| Name | (S)-1,2,3,4,5,6,7,8-Octahydro-2,5,5-Trimethyl-2-Naphthol |
|---|---|
| Synonyms | (S)-1,2,3,4,5,6,7,8-Octahydro-2,5,5-Trimethyl-2-Naphthol; 2-Naphthalenol, 1,2,3,4,5,6,7,8-Octahydro-2,5,5-Trimethyl-, (2S)-; 2-Naphthol, 1,2,3,4,5,6,7,8-Octahydro-2,5,5-Trimethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 |
| CAS Registry Number | 670-24-6 |
| EINECS | 211-575-4 |
| SMILES | CC2(C1=C(CC(O)(CC1)C)CCC2)C |
| InChI | 1S/C13H22O/c1-12(2)7-4-5-10-9-13(3,14)8-6-11(10)12/h14H,4-9H2,1-3H3 |
| InChIKey | BGWAANSABVGTHL-UHFFFAOYSA-N |
| Density | 0.986g/cm3 (Cal.) |
|---|---|
| Boiling point | 281.04°C at 760 mmHg (Cal.) |
| Flash point | 115.007°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (S)-1,2,3,4,5,6,7,8-Octahydro-2,5,5-Trimethyl-2-Naphthol |