|
CAS#: 67008-01-9 Product: Ammonium Barbiturate No suppilers available for the product. |
| Name | Ammonium Barbiturate |
|---|---|
| Synonyms | Diammonium 6-Oxo-5H-Pyrimidine-2,4-Diolate; Diammonium 6-Keto-5H-Pyrimidine-2,4-Diolate |
| Molecular Structure | ![]() |
| Molecular Formula | C4H10N4O3 |
| Molecular Weight | 162.15 |
| CAS Registry Number | 67008-01-9 |
| EINECS | 266-540-6 |
| SMILES | O=C1N=C([O-])[N-]C(=O)C1.[NH4+].[NH4+] |
| InChI | 1S/C4H4N2O3.2H3N/c7-2-1-3(8)6-4(9)5-2;;/h1H2,(H2,5,6,7,8,9);2*1H3 |
| InChIKey | XNDLCVVPLCWBGH-UHFFFAOYSA-N |
| Boiling point | 372.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 179.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ammonium Barbiturate |