| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Fragmenta | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (732) 484-9980 | |||
![]() |
sales@fragmenta.com | |||
| Chemical manufacturer | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| TimTec | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (302) 292-8500 | |||
![]() |
info@timtec.com | |||
| Chemical manufacturer | ||||
| Name | 1-(2-Chloroethyl)-4-[3-(trifluoromethyl)phenyl]piperazine dihydrochloride |
|---|---|
| Synonyms | 1-(2-Chlo |
| Molecular Structure | ![]() |
| Molecular Formula | C13H18Cl3F3N2 |
| Molecular Weight | 365.65 |
| CAS Registry Number | 670234-47-6 |
| SMILES | ClCCN1CCN(CC1)c2cc(ccc2)C(F)(F)F.Cl.Cl |
| InChI | 1S/C13H16ClF3N2.2ClH/c14-4-5-18-6-8-19(9-7-18)12-3-1-2-11(10-12)13(15,16)17;;/h1-3,10H,4-9H2;2*1H |
| InChIKey | LWBQLTGEORFBGY-UHFFFAOYSA-N |
| Boiling point | 412.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 203.3°C (Cal.) |
| Refractive index | (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2-Chloroethyl)-4-[3-(trifluoromethyl)phenyl]piperazine dihydrochloride |