|
CAS#: 67031-54-3 Product: 2-Amino-1-Phenylethyl Benzoate No suppilers available for the product. |
| Name | 2-Amino-1-Phenylethyl Benzoate |
|---|---|
| Synonyms | (2-Amino-1-Phenyl-Ethyl) Benzoate; Benzoic Acid (2-Amino-1-Phenylethyl) Ester; Benzoic Acid (2-Amino-1-Phenyl-Ethyl) Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.29 |
| CAS Registry Number | 67031-54-3 |
| SMILES | C2=C(C(OC(C1=CC=CC=C1)CN)=O)C=CC=C2 |
| InChI | 1S/C15H15NO2/c16-11-14(12-7-3-1-4-8-12)18-15(17)13-9-5-2-6-10-13/h1-10,14H,11,16H2 |
| InChIKey | JFWCBGMWRXJFDF-UHFFFAOYSA-N |
| Density | 1.155g/cm3 (Cal.) |
|---|---|
| Boiling point | 384.194°C at 760 mmHg (Cal.) |
| Flash point | 221.437°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Amino-1-Phenylethyl Benzoate |