|
CAS#: 67049-87-0 Product: Tert-Butyl(Dimethylaminocarbonothioylthio) Sulfoxide No suppilers available for the product. |
| Name | Tert-Butyl(Dimethylaminocarbonothioylthio) Sulfoxide |
|---|---|
| Synonyms | Dimethylaminomethanedithioic Acid Tert-Butylsulfinyl Ester; Usaf B-20; Carbamic Acid, Dimethyldithio-, Tert-Butylsulfinyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C7H15NOS3 |
| Molecular Weight | 225.38 |
| CAS Registry Number | 67049-87-0 |
| SMILES | CC([S](SC(=S)N(C)C)=O)(C)C |
| InChI | 1S/C7H15NOS3/c1-7(2,3)12(9)11-6(10)8(4)5/h1-5H3 |
| InChIKey | FTMZYNDRRDVWOO-UHFFFAOYSA-N |
| Density | 1.253g/cm3 (Cal.) |
|---|---|
| Boiling point | 316.191°C at 760 mmHg (Cal.) |
| Flash point | 145.028°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tert-Butyl(Dimethylaminocarbonothioylthio) Sulfoxide |