|
CAS#: 67131-98-0 Product: 4-Cyanophenyl 4-(2-butoxyethoxy)benzoate No suppilers available for the product. |
| Name | 4-Cyanophenyl 4-(2-butoxyethoxy)benzoate |
|---|---|
| Synonyms | 4-Cyanophenyl 4-(2-butoxyethoxy)benzoate # |
| Molecular Structure | ![]() |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 |
| CAS Registry Number | 67131-98-0 |
| SMILES | N#Cc2ccc(OC(=O)c1ccc(OCCOCCCC)cc1)cc2 |
| InChI | 1S/C20H21NO4/c1-2-3-12-23-13-14-24-18-10-6-17(7-11-18)20(22)25-19-8-4-16(15-21)5-9-19/h4-11H,2-3,12-14H2,1H3 |
| InChIKey | RLIQVKVERNHZFP-UHFFFAOYSA-N |
| Density | 1.174g/cm3 (Cal.) |
|---|---|
| Boiling point | 506.502°C at 760 mmHg (Cal.) |
| Flash point | 219.529°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Cyanophenyl 4-(2-butoxyethoxy)benzoate |