|
CAS#: 67159-67-5 Product: 5-Methyl-4-Phenyl-4-Propyl-1-Pyrrolin-2-Amine No suppilers available for the product. |
| Name | 5-Methyl-4-Phenyl-4-Propyl-1-Pyrrolin-2-Amine |
|---|---|
| Synonyms | (5-Methyl-4-Phenyl-4-Propyl-1-Pyrrolin-2-Yl)Amine; 1-Pyrroline, 2-Amino-5-Methyl-4-Phenyl-4-Propyl-; 2-Amino-5-Methyl-4-Phenyl-4-Propyl-1-Pyrroline |
| Molecular Structure | ![]() |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 |
| CAS Registry Number | 67159-67-5 |
| SMILES | C2=C(C1(C(N=C(N)C1)C)CCC)C=CC=C2 |
| InChI | 1S/C14H20N2/c1-3-9-14(10-13(15)16-11(14)2)12-7-5-4-6-8-12/h4-8,11H,3,9-10H2,1-2H3,(H2,15,16) |
| InChIKey | HLYCQLHDHYJHJD-UHFFFAOYSA-N |
| Density | 1.05g/cm3 (Cal.) |
|---|---|
| Boiling point | 342.256°C at 760 mmHg (Cal.) |
| Flash point | 160.791°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Methyl-4-Phenyl-4-Propyl-1-Pyrrolin-2-Amine |