|
CAS#: 67196-09-2 Product: 6-Methoxy-9-(1-Methyl-2-Piperidylmethyl)-9H-Carbazole No suppilers available for the product. |
| Name | 6-Methoxy-9-(1-Methyl-2-Piperidylmethyl)-9H-Carbazole |
|---|---|
| Synonyms | 3-Methoxy-9-[(1-Methyl-2-Piperidyl)Methyl]Carbazole; 3-Methoxy-9-[(1-Methyl-2-Piperidinyl)Methyl]Carbazole; 6-Methoxy-9-(1-Methyl-2-Piperidyl)Methylcarbazole |
| Molecular Structure | ![]() |
| Molecular Formula | C20H24N2O |
| Molecular Weight | 308.42 |
| CAS Registry Number | 67196-09-2 |
| SMILES | C1=CC(=CC2=C1[N](C3=C2C=CC=C3)CC4N(CCCC4)C)OC |
| InChI | 1S/C20H24N2O/c1-21-12-6-5-7-15(21)14-22-19-9-4-3-8-17(19)18-13-16(23-2)10-11-20(18)22/h3-4,8-11,13,15H,5-7,12,14H2,1-2H3 |
| InChIKey | BHNKWZPHYJJIRK-UHFFFAOYSA-N |
| Density | 1.156g/cm3 (Cal.) |
|---|---|
| Boiling point | 469.983°C at 760 mmHg (Cal.) |
| Flash point | 238.038°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Methoxy-9-(1-Methyl-2-Piperidylmethyl)-9H-Carbazole |