|
CAS#: 67196-51-4 Product: 5,7-Dihydro-6H-Dibenzo[a,c]Cycloheptene-6-Carboxamide No suppilers available for the product. |
| Name | 5,7-Dihydro-6H-Dibenzo[a,c]Cycloheptene-6-Carboxamide |
|---|---|
| Synonyms | 5,7-Dihydro-6H-Dibenzo(A,C)Cycloheptene-6-Carboxamide; 6H-Dibenzo(A,C)Cycloheptene-6-Carboxamide, 5,7-Dihydro-; Brn 3531715 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H15NO |
| Molecular Weight | 237.30 |
| CAS Registry Number | 67196-51-4 |
| SMILES | C3=C2C1=CC=CC=C1CC(CC2=CC=C3)C(=O)N |
| InChI | 1S/C16H15NO/c17-16(18)13-9-11-5-1-3-7-14(11)15-8-4-2-6-12(15)10-13/h1-8,13H,9-10H2,(H2,17,18) |
| InChIKey | FDRNUZNRYZMOAV-UHFFFAOYSA-N |
| Density | 1.173g/cm3 (Cal.) |
|---|---|
| Boiling point | 496.449°C at 760 mmHg (Cal.) |
| Flash point | 254.043°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,7-Dihydro-6H-Dibenzo[a,c]Cycloheptene-6-Carboxamide |