|
CAS#: 67208-09-7 Product: 3,7-Dihydro-1H-Purine-2,6-Dione, Monopotassium Salt No suppilers available for the product. |
| Name | 3,7-Dihydro-1H-Purine-2,6-Dione, Monopotassium Salt |
|---|---|
| Synonyms | Potassium 3H-Purin-7-Ide-2,6-Quinone; 3,7-Dihydro-1H-Purine-2,6-Dione, Monopotassium Salt |
| Molecular Structure | ![]() |
| Molecular Formula | C5H3KN4O2 |
| Molecular Weight | 190.20 |
| CAS Registry Number | 67208-09-7 |
| EINECS | 266-603-8 |
| SMILES | [N-]1C2=C(N=C1)C(=O)NC(=O)N2.[K+] |
| InChI | 1S/C5H4N4O2.K/c10-4-2-3(7-1-6-2)8-5(11)9-4;/h1H,(H3,6,7,8,9,10,11);/q;+1/p-1 |
| InChIKey | VWBWAALEWBNEIR-UHFFFAOYSA-M |
| Boiling point | 648.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 346.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,7-Dihydro-1H-Purine-2,6-Dione, Monopotassium Salt |