|
CAS#: 673-00-7 Product: Methyl-Carbamic acid 4-Chloro-3,5-Xylyl ester No suppilers available for the product. |
| Name | Methyl-Carbamic acid 4-Chloro-3,5-Xylyl ester |
|---|---|
| Synonyms | (4-Chloro-3,5-Dimethyl-Phenyl) N-Methylcarbamate; N-Methylcarbamic Acid (4-Chloro-3,5-Dimethylphenyl) Ester; N-Methylcarbamic Acid (4-Chloro-3,5-Dimethyl-Phenyl) Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C10H12ClNO2 |
| Molecular Weight | 213.66 |
| CAS Registry Number | 673-00-7 |
| SMILES | C1=C(C)C(=C(C)C=C1OC(NC)=O)Cl |
| InChI | 1S/C10H12ClNO2/c1-6-4-8(14-10(13)12-3)5-7(2)9(6)11/h4-5H,1-3H3,(H,12,13) |
| InChIKey | UVPPWESDRAKSEO-UHFFFAOYSA-N |
| Density | 1.185g/cm3 (Cal.) |
|---|---|
| Boiling point | 298.732°C at 760 mmHg (Cal.) |
| Flash point | 134.469°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl-Carbamic acid 4-Chloro-3,5-Xylyl ester |