Online Database of Chemicals from Around the World
|
CAS#: 67341-49-5 Product: 2,3,5,6-Tetrachloro-4-(Methylthio)Benzenethiol No suppilers available for the product. |
| Name | 2,3,5,6-Tetrachloro-4-(Methylthio)Benzenethiol |
|---|---|
| Synonyms | 2,3,5,6-Tetrachloro-4-Methylsulfanyl-Benzenethiol; 2,3,5,6-Tetrachloro-4-(Methylthio)Benzenethiol; 4-Methylthio-Tetrachlorothiophenol |
| Molecular Structure |  |
| Molecular Formula | C7H4Cl4S2 |
| Molecular Weight | 294.04 |
| CAS Registry Number | 67341-49-5 |
| SMILES | CSC1=C(C(=C(C(=C1Cl)Cl)S)Cl)Cl |
| InChI | 1S/C7H4Cl4S2/c1-13-7-4(10)2(8)6(12)3(9)5(7)11/h12H,1H3 |
| InChIKey | CLNQOCYAAXXJSR-UHFFFAOYSA-N |
| Density | 1.643g/cm3 (Cal.) |
|---|---|
| Boiling point | 347.011°C at 760 mmHg (Cal.) |
| Flash point | 163.667°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3,5,6-Tetrachloro-4-(Methylthio)Benzenethiol |