|
CAS#: 67370-02-9 Product: Angeloylzygadenine No suppilers available for the product. |
| Name | Angeloylzygadenine |
|---|---|
| Synonyms | Cevane-3,4,14,15,16,20-Hexol, 4,9-Epoxy-, 3-(2-Methyl-2-Butenoate), (3Beta(Z),4Alpha,15Alpha,16Beta)- |
| Molecular Structure | ![]() |
| Molecular Formula | C32H49NO8 |
| Molecular Weight | 575.74 |
| CAS Registry Number | 67370-02-9 |
| SMILES | [C@@H]1(CC[C@]2(C3[C@]1(O)OC27[C@@H](CC3)C6([C@H]([C@@H]([C@@H]5[C@@](C)([C@@H]4CC[C@H](C)CN4C[C@H]5[C@@H]6C7)O)O)O)O)C)OC(C(=C\C)/C)=O |
| InChI | 1S/C32H49NO8/c1-6-17(3)27(36)40-23-11-12-28(4)20-8-9-21-30(28,41-32(20,23)39)13-19-18-15-33-14-16(2)7-10-22(33)29(5,37)24(18)25(34)26(35)31(19,21)38/h6,16,18-26,34-35,37-39H,7-15H2,1-5H3/b17-6-/t16-,18-,19-,20?,21+,22-,23-,24+,25+,26-,28-,29+,30?,31?,32-/m0/s1 |
| InChIKey | VZBCOPRNVQLISP-PSQKXIODSA-N |
| Density | 1.363g/cm3 (Cal.) |
|---|---|
| Boiling point | 692.226°C at 760 mmHg (Cal.) |
| Flash point | 372.445°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Angeloylzygadenine |