|
CAS#: 67370-67-6 Product: Methyl 6-{[(4-methylphenyl)sulfonyl]amino}hexanoate No suppilers available for the product. |
| Name | Methyl 6-{[(4-methylphenyl)sulfonyl]amino}hexanoate |
|---|---|
| Synonyms | ZINC07306444 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H21NO4S |
| Molecular Weight | 299.39 |
| CAS Registry Number | 67370-67-6 |
| SMILES | O=S(=O)(c1ccc(cc1)C)NCCCCCC(=O)OC |
| InChI | 1S/C14H21NO4S/c1-12-7-9-13(10-8-12)20(17,18)15-11-5-3-4-6-14(16)19-2/h7-10,15H,3-6,11H2,1-2H3 |
| InChIKey | FSLIGSSDBNSKQQ-UHFFFAOYSA-N |
| Density | 1.157g/cm3 (Cal.) |
|---|---|
| Boiling point | 419.274°C at 760 mmHg (Cal.) |
| Flash point | 207.37°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 6-{[(4-methylphenyl)sulfonyl]amino}hexanoate |