|
CAS#: 6739-21-5 Product: 3-(4-Hydroxyphenyl)Butanoic Acid No suppilers available for the product. |
| Name | 3-(4-Hydroxyphenyl)Butanoic Acid |
|---|---|
| Synonyms | 3-(4-Hydroxyphenyl)Butyric Acid; Oprea1_311284; St5440483 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 |
| CAS Registry Number | 6739-21-5 |
| SMILES | C1=CC(=CC=C1C(C)CC(O)=O)O |
| InChI | 1S/C10H12O3/c1-7(6-10(12)13)8-2-4-9(11)5-3-8/h2-5,7,11H,6H2,1H3,(H,12,13) |
| InChIKey | JZOJWPRZSMYTTI-UHFFFAOYSA-N |
| Density | 1.209g/cm3 (Cal.) |
|---|---|
| Boiling point | 338.775°C at 760 mmHg (Cal.) |
| Flash point | 172.888°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 3-(4-Hydroxyphenyl)Butanoic Acid |