|
CAS#: 67428-03-9 Product: Nitrous Acid 2-Phenylethyl-2,2-D2 Ester No suppilers available for the product. |
| Name | Nitrous Acid 2-Phenylethyl-2,2-D2 Ester |
|---|---|
| Synonyms | (2,2-Dideuterio-2-Phenyl-Ethyl) Nitrite; Nitrous Acid (2,2-Dideuterio-2-Phenylethyl) Ester; Nitrous Acid (2,2-Dideuterio-2-Phenyl-Ethyl) Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C8H7D2NO2 |
| Molecular Weight | 153.18 |
| CAS Registry Number | 67428-03-9 |
| SMILES | C1=C(C=CC=C1)C(CON=O)([2H])[2H] |
| InChI | 1S/C8H9NO2/c10-9-11-7-6-8-4-2-1-3-5-8/h1-5H,6-7H2/i6D2 |
| InChIKey | UYFFAINCSURFJZ-NCYHJHSESA-N |
| Density | 1.085g/cm3 (Cal.) |
|---|---|
| Boiling point | 205.497°C at 760 mmHg (Cal.) |
| Flash point | 83.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Nitrous Acid 2-Phenylethyl-2,2-D2 Ester |