|
CAS#: 67465-28-5 Product: 1-(Ethylsulfonyl)-1-Ethylpropylpiperidino Ketone No suppilers available for the product. |
| Name | 1-(Ethylsulfonyl)-1-Ethylpropylpiperidino Ketone |
|---|---|
| Synonyms | 4-Ethylsulfonyl-1-(1-Piperidyl)Hexan-1-One; 4-Ethylsulfonyl-1-Piperidino-Hexan-1-One; 4-Ethylsulfonyl-1-Piperidin-1-Yl-Hexan-1-One |
| Molecular Structure | ![]() |
| Molecular Formula | C13H25NO3S |
| Molecular Weight | 275.41 |
| CAS Registry Number | 67465-28-5 |
| SMILES | C(C([S](CC)(=O)=O)CC)CC(N1CCCCC1)=O |
| InChI | 1S/C13H25NO3S/c1-3-12(18(16,17)4-2)8-9-13(15)14-10-6-5-7-11-14/h12H,3-11H2,1-2H3 |
| InChIKey | YXWVGEKYHLCSSX-UHFFFAOYSA-N |
| Density | 1.105g/cm3 (Cal.) |
|---|---|
| Boiling point | 478.761°C at 760 mmHg (Cal.) |
| Flash point | 243.346°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(Ethylsulfonyl)-1-Ethylpropylpiperidino Ketone |