|
CAS#: 67496-60-0 Product: Nitriloprostaglandin I2 No suppilers available for the product. |
| Name | Nitriloprostaglandin I2 |
|---|---|
| Synonyms | 5-[(3Ar,4R,5R,6As)-5-Hydroxy-4-[(E,3S)-3-Hydroxyoct-1-Enyl]-3,3A,4,5,6,6A-Hexahydrocyclopenta[D]Pyrrol-2-Yl]Valeric Acid; 9-Deoxy-9 Alpha,6-Nitrilo-Pgf1alpha Hydrochloride; Cyclopenta(B)Pyrrole-2-Pentanoic Acid, 3,3A,4,5,6,6A-Hexahydro-5-Hydroxy-4-(3-Hydroxy-1-Octenyl)-, (3Ar-(3Aalpha,4Alpha(1E,3S*),5Beta,6Aalpha))- |
| Molecular Structure | ![]() |
| Molecular Formula | C20H33NO4 |
| Molecular Weight | 351.49 |
| CAS Registry Number | 67496-60-0 |
| SMILES | [C@@H]12[C@@H](N=C(C1)CCCCC(=O)O)C[C@@H](O)[C@@H]2\C=C\[C@@H](O)CCCCC |
| InChI | 1S/C20H33NO4/c1-2-3-4-8-15(22)10-11-16-17-12-14(7-5-6-9-20(24)25)21-18(17)13-19(16)23/h10-11,15-19,22-23H,2-9,12-13H2,1H3,(H,24,25)/b11-10+/t15-,16+,17+,18-,19+/m0/s1 |
| InChIKey | UWNHUGLBZPBSGW-RFMDEJACSA-N |
| Density | 1.21g/cm3 (Cal.) |
|---|---|
| Boiling point | 519.216°C at 760 mmHg (Cal.) |
| Flash point | 267.813°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Nitriloprostaglandin I2 |