|
CAS#: 67528-17-0 Product: 2-Dehydrosparteine No suppilers available for the product. |
| Name | 2-Dehydrosparteine |
|---|---|
| Synonyms | (7S,7Ar,14R,14As)-1,3,4,7,7A,8,9,13,14,14A-Decahydro-7,14-Methano-2H,6H-Dipyrido[1,2-A:1',2'-E][1,5]Diazocine; 2,3-Didehydrosparteine; 2-Dehydrosparteine |
| Molecular Structure | ![]() |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 |
| CAS Registry Number | 67528-17-0 |
| SMILES | [C@@H]13[C@H]4N(C[C@@H]([C@@H]2N(C1)C=CCC2)C3)CCCC4 |
| InChI | 1S/C15H24N2/c1-3-7-16-11-13-9-12(14(16)5-1)10-17-8-4-2-6-15(13)17/h3,7,12-15H,1-2,4-6,8-11H2/t12-,13-,14+,15-/m0/s1 |
| InChIKey | BWKNRAAXVUYXAH-XQLPTFJDSA-N |
| Density | 1.108g/cm3 (Cal.) |
|---|---|
| Boiling point | 352.406°C at 760 mmHg (Cal.) |
| Flash point | 155.206°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Dehydrosparteine |