|
CAS#: 67584-56-9 Product: 2-[Methyl[(Undecafluoropentyl)Sulphonyl]Amino]Ethyl Acrylate No suppilers available for the product. |
| Name | 2-[Methyl[(Undecafluoropentyl)Sulphonyl]Amino]Ethyl Acrylate |
|---|---|
| Synonyms | Prop-2-Enoic Acid 2-(Methyl-(1,1,2,2,3,3,4,4,5,5,5-Undecafluoropentylsulfonyl)Amino)Ethyl Ester; Acrylic Acid 2-(Methyl-(1,1,2,2,3,3,4,4,5,5,5-Undecafluoropentylsulfonyl)Amino)Ethyl Ester; 2-(Methyl((Undecafluoropentyl)Sulphonyl)Amino)Ethyl Acrylate |
| Molecular Structure | ![]() |
| Molecular Formula | C11H10F11NO4S |
| Molecular Weight | 461.25 |
| CAS Registry Number | 67584-56-9 |
| EINECS | 266-734-0 |
| SMILES | C(N([S](=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C)COC(=O)C=C |
| InChI | 1S/C11H10F11NO4S/c1-3-6(24)27-5-4-23(2)28(25,26)11(21,22)9(16,17)7(12,13)8(14,15)10(18,19)20/h3H,1,4-5H2,2H3 |
| InChIKey | FZWFDJBZTLTRGH-UHFFFAOYSA-N |
| Density | 1.552g/cm3 (Cal.) |
|---|---|
| Boiling point | 312.286°C at 760 mmHg (Cal.) |
| Flash point | 142.666°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[Methyl[(Undecafluoropentyl)Sulphonyl]Amino]Ethyl Acrylate |