| DSL Chemicals (Shanghai) Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (21) 6352-9955 | |||
![]() |
info@dsl-chem.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 4'-Pentyl-4-biphenylcarboxamide |
|---|---|
| Synonyms | 4-(4-Amylphenyl)Benzamide; (1,1'-Biphenyl)-4-Carboxamide, 4'-Pentyl-; P-Pentylbiphenyl-P'-Carboxamide |
| Molecular Structure | ![]() |
| Molecular Formula | C18H21NO |
| Molecular Weight | 267.37 |
| CAS Registry Number | 67613-13-2 |
| SMILES | C1=C(C=CC(=C1)C2=CC=C(C=C2)CCCCC)C(=O)N |
| InChI | 1S/C18H21NO/c1-2-3-4-5-14-6-8-15(9-7-14)16-10-12-17(13-11-16)18(19)20/h6-13H,2-5H2,1H3,(H2,19,20) |
| InChIKey | QKZLRKYRAYGYOV-UHFFFAOYSA-N |
| Density | 1.045g/cm3 (Cal.) |
|---|---|
| Boiling point | 433.455°C at 760 mmHg (Cal.) |
| Flash point | 215.946°C (Cal.) |
| (1) | John H. MacMillan and Mortimer M. Labes. Low Transition Temperature Liquid Crystalline Amines Incorporating the Biphenyl Ring System, Molecular Crystals and Liquid Crystals Letters, Vol. 56, p51, (1979 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4'-Pentyl-4-biphenylcarboxamide |