|
CAS#: 67633-88-9 Product: Ammonium Octyl Sulphate No suppilers available for the product. |
| Name | Ammonium Octyl Sulphate |
|---|---|
| Synonyms | Ammonium Octyl Sulfate; Monooctyl Sulfate, Ammonium Salt; Sulfuric Acid, Monooctyl Ester, Ammonium Salt |
| Molecular Structure | ![]() |
| Molecular Formula | C8H21NO4S |
| Molecular Weight | 227.32 |
| CAS Registry Number | 67633-88-9 |
| EINECS | 266-789-0 |
| SMILES | C(CCCC)CCCO[S]([O-])(=O)=O.[NH4+] |
| InChI | 1S/C8H18O4S.H3N/c1-2-3-4-5-6-7-8-12-13(9,10)11;/h2-8H2,1H3,(H,9,10,11);1H3 |
| InChIKey | PYWCSLGSEKAVNK-UHFFFAOYSA-N |
| Boiling point | 364.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 174.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ammonium Octyl Sulphate |