|
CAS#: 67646-65-5 Product: Methylsulfonylpentachlorobenzene No suppilers available for the product. |
| Name | Methylsulfonylpentachlorobenzene |
|---|---|
| Synonyms | 1,2,3,4,5-Pentachloro-6-Methylsulfonyl-Benzene; 1,2,3,4,5-Pentachloro-6-Mesyl-Benzene; Pcpso2me |
| Molecular Structure | ![]() |
| Molecular Formula | C7H3Cl5O2S |
| Molecular Weight | 328.42 |
| CAS Registry Number | 67646-65-5 |
| SMILES | C[S](C1=C(C(=C(Cl)C(=C1Cl)Cl)Cl)Cl)(=O)=O |
| InChI | 1S/C7H3Cl5O2S/c1-15(13,14)7-5(11)3(9)2(8)4(10)6(7)12/h1H3 |
| InChIKey | VMFKDZZSEHJOSP-UHFFFAOYSA-N |
| Density | 1.72g/cm3 (Cal.) |
|---|---|
| Boiling point | 461.869°C at 760 mmHg (Cal.) |
| Flash point | 233.13°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methylsulfonylpentachlorobenzene |