|
CAS#: 67663-03-0 Product: 1-(3-Butyl-4-Methylphenyl)Ethan-1-One No suppilers available for the product. |
| Name | 1-(3-Butyl-4-Methylphenyl)Ethan-1-One |
|---|---|
| Synonyms | 1-(3-Butyl-4-Methyl-Phenyl)Ethanone; 1-(3-Butyl-4-Methylphenyl)Ethan-1-One |
| Molecular Structure | ![]() |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.28 |
| CAS Registry Number | 67663-03-0 |
| EINECS | 266-849-6 |
| SMILES | C1=C(C)C(=CC(=C1)C(=O)C)CCCC |
| InChI | 1S/C13H18O/c1-4-5-6-12-9-13(11(3)14)8-7-10(12)2/h7-9H,4-6H2,1-3H3 |
| InChIKey | POZXPCYPGRBKIL-UHFFFAOYSA-N |
| Density | 0.937g/cm3 (Cal.) |
|---|---|
| Boiling point | 297.109°C at 760 mmHg (Cal.) |
| Flash point | 123.065°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(3-Butyl-4-Methylphenyl)Ethan-1-One |