|
CAS#: 67697-31-8 Product: 2-[(1-Ethyl-2-Methyl-1H-Indol-3-Yl)Carbonyl]Terephthalic Acid No suppilers available for the product. |
| Name | 2-[(1-Ethyl-2-Methyl-1H-Indol-3-Yl)Carbonyl]Terephthalic Acid |
|---|---|
| Synonyms | 2-(1-Ethyl-2-Methyl-Indole-3-Carbonyl)Terephthalic Acid; 2-[(1-Ethyl-2-Methyl-3-Indolyl)-Oxomethyl]Terephthalic Acid; 2-(1-Ethyl-2-Methyl-Indol-3-Yl)Carbonylterephthalic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C20H17NO5 |
| Molecular Weight | 351.36 |
| CAS Registry Number | 67697-31-8 |
| EINECS | 266-910-7 |
| SMILES | C1=CC2=C(C=C1)C(=C([N]2CC)C)C(=O)C3=C(C=CC(=C3)C(=O)O)C(=O)O |
| InChI | 1S/C20H17NO5/c1-3-21-11(2)17(14-6-4-5-7-16(14)21)18(22)15-10-12(19(23)24)8-9-13(15)20(25)26/h4-10H,3H2,1-2H3,(H,23,24)(H,25,26) |
| InChIKey | ZXJGBGUTCPMOCU-UHFFFAOYSA-N |
| Density | 1.329g/cm3 (Cal.) |
|---|---|
| Boiling point | 625.517°C at 760 mmHg (Cal.) |
| Flash point | 332.101°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[(1-Ethyl-2-Methyl-1H-Indol-3-Yl)Carbonyl]Terephthalic Acid |