|
CAS#: 67705-05-9 Product: Tetrakis(trifluoromethyl)furan No suppilers available for the product. |
| Name | Tetrakis(trifluoromethyl)furan |
|---|---|
| Synonyms | 2,3,4,5-Tetrakis(trifluoromethyl)furan # |
| Molecular Structure | ![]() |
| Molecular Formula | C8F12O |
| Molecular Weight | 340.07 |
| CAS Registry Number | 67705-05-9 |
| SMILES | FC(F)(F)c1c(c(oc1C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | 1S/C8F12O/c9-5(10,11)1-2(6(12,13)14)4(8(18,19)20)21-3(1)7(15,16)17 |
| InChIKey | JWLJCRKZSYFANA-UHFFFAOYSA-N |
| Density | 1.649g/cm3 (Cal.) |
|---|---|
| Boiling point | 99.148°C at 760 mmHg (Cal.) |
| Flash point | 13.765°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tetrakis(trifluoromethyl)furan |