Online Database of Chemicals from Around the World
|
CAS#: 67739-11-1 Product: 2-Methyl-1-(Methylbicyclo2.2.1Hept-5-En-2-Yl)-1-Penten-3-Ol No suppilers available for the product. |
| Name | 2-Methyl-1-(Methylbicyclo2.2.1Hept-5-En-2-Yl)-1-Penten-3-Ol |
|---|---|
| Synonyms | 1-Penten-3-Ol, 2-Methyl-1-(Methylbicyclo(2.2.1)Hept-5-En-2-Yl)-; Methyl Sandeflor |
| Molecular Structure |  |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 |
| CAS Registry Number | 67739-11-1 |
| SMILES | C(C(O)C(=C/C1(C2CC(C1)C=C2)C)/C)C |
| InChI | 1S/C14H22O/c1-4-13(15)10(2)8-14(3)9-11-5-6-12(14)7-11/h5-6,8,11-13,15H,4,7,9H2,1-3H3/b10-8+ |
| InChIKey | RZXAQFGBENAOAJ-CSKARUKUSA-N |
| Density | 1.032g/cm3 (Cal.) |
|---|---|
| Boiling point | 295.524°C at 760 mmHg (Cal.) |
| Flash point | 112.736°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-1-(Methylbicyclo2.2.1Hept-5-En-2-Yl)-1-Penten-3-Ol |