|
CAS#: 67774-32-7 Product: 2,2',4,4',5,5'-Hexabromo-1,1'-biphenyl No suppilers available for the product. |
| Name | 2,2',4,4',5,5'-Hexabromo-1,1'-biphenyl |
|---|---|
| Synonyms | Pbb; Hexabromobiphenyl; Polybrominated Biphenyl Mixture |
| Molecular Structure | ![]() |
| Molecular Formula | C12H4Br6 |
| Molecular Weight | 627.59 |
| CAS Registry Number | 67774-32-7 |
| SMILES | C2=C(C1=CC(=C(C=C1Br)Br)Br)C(=CC(=C2Br)Br)Br |
| InChI | 1S/C12H4Br6/c13-7-3-11(17)9(15)1-5(7)6-2-10(16)12(18)4-8(6)14/h1-4H |
| InChIKey | HMBBJSKXDBUNNT-UHFFFAOYSA-N |
| Density | 2.492g/cm3 (Cal.) |
|---|---|
| Boiling point | 474.389°C at 760 mmHg (Cal.) |
| Flash point | 231.944°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2',4,4',5,5'-Hexabromo-1,1'-biphenyl |