|
CAS#: 67800-86-6 Product: 2-Ethoxy-1,3,3-Trimethylbicyclo[2.2.1]Heptane No suppilers available for the product. |
| Name | 2-Ethoxy-1,3,3-Trimethylbicyclo[2.2.1]Heptane |
|---|---|
| Synonyms | 2-Ethoxy-1,3,3-Trimethyl-Norbornane; 2-Ethoxy-1,3,3-Trimethylnorbornane; 6-Ethoxy-1,5,5-Trimethyl-Bicyclo[2.2.1]Heptane |
| Molecular Structure | ![]() |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 |
| CAS Registry Number | 67800-86-6 |
| EINECS | 267-111-6 |
| SMILES | C(OC2C1(CC(CC1)C2(C)C)C)C |
| InChI | 1S/C12H22O/c1-5-13-10-11(2,3)9-6-7-12(10,4)8-9/h9-10H,5-8H2,1-4H3 |
| InChIKey | OGKAJQBGLDYVDV-UHFFFAOYSA-N |
| Density | 0.922g/cm3 (Cal.) |
|---|---|
| Boiling point | 205.938°C at 760 mmHg (Cal.) |
| Flash point | 70.604°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Ethoxy-1,3,3-Trimethylbicyclo[2.2.1]Heptane |