Online Database of Chemicals from Around the World
|
CAS#: 67801-53-0 Product: Dimethyl 4'-Methyl[1,1'-Biphenyl]-2,5-Dicarboxylate No suppilers available for the product. |
| Name | Dimethyl 4'-Methyl[1,1'-Biphenyl]-2,5-Dicarboxylate |
|---|---|
| Synonyms | 2-(4-Methylphenyl)Benzene-1,4-Dicarboxylic Acid Dimethyl Ester; (1,1'-Biphenyl)-2,5-Dicarboxylic Acid, 4'-Methyl-, Dimethyl Ester; Dimethyl 4'-Methyl(1,1'-Biphenyl)-2,5-Dicarboxylate |
| Molecular Structure | ![CAS#: 67801-53-0, Dimethyl 4'-Methyl[1,1'-Biphenyl]-2,5-Dicarboxylate](/moreStructures/67801-53-0.gif) |
| Molecular Formula | C17H16O4 |
| Molecular Weight | 284.31 |
| CAS Registry Number | 67801-53-0 |
| EINECS | 267-172-9 |
| SMILES | C1=CC(=CC=C1C)C2=C(C=CC(=C2)C(=O)OC)C(=O)OC |
| InChI | 1S/C17H16O4/c1-11-4-6-12(7-5-11)15-10-13(16(18)20-2)8-9-14(15)17(19)21-3/h4-10H,1-3H3 |
| InChIKey | LETKDZPIJVKUHW-UHFFFAOYSA-N |
| Density | 1.152g/cm3 (Cal.) |
|---|---|
| Boiling point | 438.341°C at 760 mmHg (Cal.) |
| Flash point | 221.776°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dimethyl 4'-Methyl[1,1'-Biphenyl]-2,5-Dicarboxylate |