|
CAS#: 67814-48-6 Product: 1,2,6-Trimethyltricyclo[5.3.2.02,7]Dodecan-5-One No suppilers available for the product. |
| Name | 1,2,6-Trimethyltricyclo[5.3.2.02,7]Dodecan-5-One |
|---|---|
| Synonyms | 2H-1,4A-Ethanonaphthalen-6(5H)-One, Hexahydro-1,5,8A-Trimethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.35 |
| CAS Registry Number | 67814-48-6 |
| SMILES | CC23C1(CCC(=O)C(C)C1(CC2)CCC3)C |
| InChI | 1S/C15H24O/c1-11-12(16)5-8-14(3)13(2)6-4-7-15(11,14)10-9-13/h11H,4-10H2,1-3H3 |
| InChIKey | JQHYUGVPUKWTMN-UHFFFAOYSA-N |
| Density | 1.008g/cm3 (Cal.) |
|---|---|
| Boiling point | 292.732°C at 760 mmHg (Cal.) |
| Flash point | 123.279°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,6-Trimethyltricyclo[5.3.2.02,7]Dodecan-5-One |