|
CAS#: 67827-56-9 Product: 2-Chloro-1,3,5-Trimethoxybenzene No suppilers available for the product. |
| Name | 2-Chloro-1,3,5-Trimethoxybenzene |
|---|---|
| Synonyms | 2-Chloro-1,3,5-Trimethoxy-Benzene; Chlorophloroglucinol Trimethyl Ether; Nsc151978 |
| Molecular Structure | ![]() |
| Molecular Formula | C9H11ClO3 |
| Molecular Weight | 202.64 |
| CAS Registry Number | 67827-56-9 |
| SMILES | C1=C(C(=C(C=C1OC)OC)Cl)OC |
| InChI | 1S/C9H11ClO3/c1-11-6-4-7(12-2)9(10)8(5-6)13-3/h4-5H,1-3H3 |
| InChIKey | RLLPSYLJYVMSBI-UHFFFAOYSA-N |
| Density | 1.169g/cm3 (Cal.) |
|---|---|
| Boiling point | 287.975°C at 760 mmHg (Cal.) |
| Flash point | 112.756°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Chloro-1,3,5-Trimethoxybenzene |