|
CAS#: 67828-41-5 Product: 3,5-Dichloro-4-Ethoxytoluene No suppilers available for the product. |
| Name | 3,5-Dichloro-4-Ethoxytoluene |
|---|---|
| Synonyms | 1,3-Dichloro-2-Ethoxy-5-Methyl-Benzene; 3,5-Dichloro-4-Ethoxytoluene; Benzene, 1,3-Dichloro-2-Ethoxy-5-Methyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C9H10Cl2O |
| Molecular Weight | 205.08 |
| CAS Registry Number | 67828-41-5 |
| EINECS | 267-263-3 |
| SMILES | C1=C(C=C(C(=C1Cl)OCC)Cl)C |
| InChI | 1S/C9H10Cl2O/c1-3-12-9-7(10)4-6(2)5-8(9)11/h4-5H,3H2,1-2H3 |
| InChIKey | RJPFGDAVUZZKMS-UHFFFAOYSA-N |
| Density | 1.206g/cm3 (Cal.) |
|---|---|
| Boiling point | 265.079°C at 760 mmHg (Cal.) |
| Flash point | 82.862°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,5-Dichloro-4-Ethoxytoluene |