|
CAS#: 67845-48-1 Product: (E)-1-(3,7-Dimethylocta-2,6-Dienyl)-1H-Indole No suppilers available for the product. |
| Name | (E)-1-(3,7-Dimethylocta-2,6-Dienyl)-1H-Indole |
|---|---|
| Synonyms | Geranyl Indole; (E)-1-(3,7-Dimethylocta-2,6-Dienyl)-1H-Indole; 1H-Indole, 1-((2E)-3,7-Dimethyl-2,6-Octadienyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C18H23N |
| Molecular Weight | 253.39 |
| CAS Registry Number | 67845-48-1 |
| EINECS | 267-319-7 |
| SMILES | C1=CC2=C(C=C1)C=C[N]2C\C=C(C)\CCC=C(C)C |
| InChI | 1S/C18H23N/c1-15(2)7-6-8-16(3)11-13-19-14-12-17-9-4-5-10-18(17)19/h4-5,7,9-12,14H,6,8,13H2,1-3H3/b16-11+ |
| InChIKey | BRAYSEBRLMYPDQ-LFIBNONCSA-N |
| Density | 0.926g/cm3 (Cal.) |
|---|---|
| Boiling point | 391.248°C at 760 mmHg (Cal.) |
| Flash point | 190.42°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (E)-1-(3,7-Dimethylocta-2,6-Dienyl)-1H-Indole |