|
CAS#: 67857-97-0 Product: 4-(2-Nitro-Phenyl)-Butyric Acid No suppilers available for the product. |
| Name | 4-(2-Nitro-Phenyl)-Butyric Acid |
|---|---|
| Synonyms | 4-(2-Nitrophenyl)Butyric Acid; Nsc79881; St5444702 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.20 |
| CAS Registry Number | 67857-97-0 |
| SMILES | C1=CC=CC(=C1CCCC(O)=O)[N+](=O)[O-] |
| InChI | 1S/C10H11NO4/c12-10(13)7-3-5-8-4-1-2-6-9(8)11(14)15/h1-2,4,6H,3,5,7H2,(H,12,13) |
| InChIKey | BMGIMCRPRTWLTE-UHFFFAOYSA-N |
| Density | 1.294g/cm3 (Cal.) |
|---|---|
| Boiling point | 366.926°C at 760 mmHg (Cal.) |
| Flash point | 159.55°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4-(2-Nitro-Phenyl)-Butyric Acid |