|
CAS#: 67860-11-1 Product: 1,3,3-Trimethylbicyclo[2.2.1]Heptan-2-Ol Propanoate No suppilers available for the product. |
| Name | 1,3,3-Trimethylbicyclo[2.2.1]Heptan-2-Ol Propanoate |
|---|---|
| Synonyms | (1,3,3-Trimethylnorbornan-2-Yl) Propanoate; Propanoic Acid (1,3,3-Trimethyl-2-Norbornanyl) Ester; Propionic Acid (1,3,3-Trimethylnorbornan-2-Yl) Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 |
| CAS Registry Number | 67860-11-1 |
| SMILES | C(C(OC2C1(CC(CC1)C2(C)C)C)=O)C |
| InChI | 1S/C13H22O2/c1-5-10(14)15-11-12(2,3)9-6-7-13(11,4)8-9/h9,11H,5-8H2,1-4H3 |
| InChIKey | UUBGRKCIBHMJQC-UHFFFAOYSA-N |
| Density | 0.996g/cm3 (Cal.) |
|---|---|
| Boiling point | 237.205°C at 760 mmHg (Cal.) |
| Flash point | 99.324°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3,3-Trimethylbicyclo[2.2.1]Heptan-2-Ol Propanoate |