|
CAS#: 67874-82-2 Product: 1,3,4,5,6,7-Hexahydro-1,1,5,5-Tetramethyl-2H-2,4alpha-Methanonaphthalen-7-Yl Formate No suppilers available for the product. |
| Name | 1,3,4,5,6,7-Hexahydro-1,1,5,5-Tetramethyl-2H-2,4alpha-Methanonaphthalen-7-Yl Formate |
|---|---|
| Synonyms | 2H-2,4A-Methanonaphthalen-7-Ol, 1,3,4,5,6,7-Hexahydro-1,1,5,5-Tetramethyl-, Formate |
| Molecular Structure | ![]() |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.36 |
| CAS Registry Number | 67874-82-2 |
| EINECS | 267-511-0 |
| SMILES | CC2(C1CC3(CC1)C(CC(OC=O)C=C23)(C)C)C |
| InChI | 1S/C16H24O2/c1-14(2)9-12(18-10-17)7-13-15(3,4)11-5-6-16(13,14)8-11/h7,10-12H,5-6,8-9H2,1-4H3 |
| InChIKey | WJZMQDGXHGRQSQ-UHFFFAOYSA-N |
| Density | 1.057g/cm3 (Cal.) |
|---|---|
| Boiling point | 319.911°C at 760 mmHg (Cal.) |
| Flash point | 131.684°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3,4,5,6,7-Hexahydro-1,1,5,5-Tetramethyl-2H-2,4alpha-Methanonaphthalen-7-Yl Formate |