Online Database of Chemicals from Around the World
|
CAS#: 67905-36-6 Product: 3,4,5,6-Tetrachloro-N-Cycloheptylphthalimide No suppilers available for the product. |
| Name | 3,4,5,6-Tetrachloro-N-Cycloheptylphthalimide |
|---|---|
| Synonyms | 4,5,6,7-Tetrachloro-2-Cycloheptyl-Isoindoline-1,3-Dione; 4,5,6,7-Tetrachloro-2-Cycloheptylisoindoline-1,3-Dione; 4,5,6,7-Tetrachloro-2-Cycloheptyl-Isoindoline-1,3-Quinone |
| Molecular Structure |  |
| Molecular Formula | C15H13Cl4NO2 |
| Molecular Weight | 381.09 |
| CAS Registry Number | 67905-36-6 |
| EINECS | 267-655-4 |
| SMILES | C1(=C(Cl)C2=C(C(=C1Cl)Cl)C(=O)N(C2=O)C3CCCCCC3)Cl |
| InChI | 1S/C15H13Cl4NO2/c16-10-8-9(11(17)13(19)12(10)18)15(22)20(14(8)21)7-5-3-1-2-4-6-7/h7H,1-6H2 |
| InChIKey | LDTIOTLLBPWEAH-UHFFFAOYSA-N |
| Density | 1.535g/cm3 (Cal.) |
|---|---|
| Boiling point | 509.209°C at 760 mmHg (Cal.) |
| Flash point | 261.76°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,4,5,6-Tetrachloro-N-Cycloheptylphthalimide |