|
CAS#: 67906-40-5 Product: 4-[Methyl[(Undecafluoropentyl)Sulphonyl]Amino]Butyl Methacrylate No suppilers available for the product. |
| Name | 4-[Methyl[(Undecafluoropentyl)Sulphonyl]Amino]Butyl Methacrylate |
|---|---|
| Synonyms | 2-Methylprop-2-Enoic Acid 4-(Methyl-(1,1,2,2,3,3,4,4,5,5,5-Undecafluoropentylsulfonyl)Amino)Butyl Ester; 2-Methylacrylic Acid 4-(Methyl-(1,1,2,2,3,3,4,4,5,5,5-Undecafluoropentylsulfonyl)Amino)Butyl Ester; 2-Methyl-2-Propenoic Acid, 4-(Methyl((Undecafluoropentyl)Sulfonyl)Amino)Butyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C14H16F11NO4S |
| Molecular Weight | 503.33 |
| CAS Registry Number | 67906-40-5 |
| EINECS | 267-707-6 |
| SMILES | C(N([S](=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C)CCCOC(=O)C(=C)C |
| InChI | 1S/C14H16F11NO4S/c1-8(2)9(27)30-7-5-4-6-26(3)31(28,29)14(24,25)12(19,20)10(15,16)11(17,18)13(21,22)23/h1,4-7H2,2-3H3 |
| InChIKey | OSMPUFUJALYWAR-UHFFFAOYSA-N |
| Density | 1.453g/cm3 (Cal.) |
|---|---|
| Boiling point | 359.178°C at 760 mmHg (Cal.) |
| Flash point | 171.025°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[Methyl[(Undecafluoropentyl)Sulphonyl]Amino]Butyl Methacrylate |