|
CAS#: 67924-12-3 Product: Bis(5-Methyl-1H-Benzotriazole) Sulphate No suppilers available for the product. |
| Name | Bis(5-Methyl-1H-Benzotriazole) Sulphate |
|---|---|
| Synonyms | 1H-Benzotriazole, 5-Methyl-, Sulfate (2:1); 5-Methylbenzotriazole, Sulfate (2:1); Bis(5-Methyl-1H-Benzotriazole) Sulphate |
| Molecular Structure | ![]() |
| Molecular Formula | C14H16N6O4S |
| Molecular Weight | 364.38 |
| CAS Registry Number | 67924-12-3 |
| EINECS | 267-797-7 |
| SMILES | O=[S](=O)(O)O.C1=C(C=CC2=N[NH]N=C12)C.C3=C(C=CC4=N[NH]N=C34)C |
| InChI | 1S/2C7H7N3.H2O4S/c2*1-5-2-3-6-7(4-5)9-10-8-6;1-5(2,3)4/h2*2-4H,1H3,(H,8,9,10);(H2,1,2,3,4) |
| InChIKey | JHIBBNOMBJPZGC-UHFFFAOYSA-N |
| Boiling point | 289.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 137.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis(5-Methyl-1H-Benzotriazole) Sulphate |