|
CAS#: 67938-71-0 Product: 2-Amino-2-(5-Chloropyridin-2-Yl)Acetic Acid No suppilers available for the product. |
| Name | 2-Amino-2-(5-Chloropyridin-2-Yl)Acetic Acid |
|---|---|
| Synonyms | 2-Amino-2-(5-Chloro-2-Pyridyl)Acetic Acid; 2-Amino-2-(5-Chloropyridin-2-Yl)Ethanoic Acid; Nsc293853 |
| Molecular Structure | ![]() |
| Molecular Formula | C7H7ClN2O2 |
| Molecular Weight | 186.60 |
| CAS Registry Number | 67938-71-0 |
| SMILES | C1=CC(=NC=C1Cl)C(N)C(O)=O |
| InChI | 1S/C7H7ClN2O2/c8-4-1-2-5(10-3-4)6(9)7(11)12/h1-3,6H,9H2,(H,11,12) |
| InChIKey | QEAXDODHZZERPP-UHFFFAOYSA-N |
| Density | 1.475g/cm3 (Cal.) |
|---|---|
| Boiling point | 332.197°C at 760 mmHg (Cal.) |
| Flash point | 154.708°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Amino-2-(5-Chloropyridin-2-Yl)Acetic Acid |