|
CAS#: 67939-61-1 Product: 4-[Methyl[(Tridecafluorohexyl)Sulphonyl]Amino]Butyl Methacrylate No suppilers available for the product. |
| Name | 4-[Methyl[(Tridecafluorohexyl)Sulphonyl]Amino]Butyl Methacrylate |
|---|---|
| Synonyms | 2-Methylprop-2-Enoic Acid 4-(Methyl-(1,1,2,2,3,3,4,4,5,5,6,6,6-Tridecafluorohexylsulfonyl)Amino)Butyl Ester; 2-Methylacrylic Acid 4-(Methyl-(1,1,2,2,3,3,4,4,5,5,6,6,6-Tridecafluorohexylsulfonyl)Amino)Butyl Ester; 4-(Methyl((Tridecafluorohexyl)Sulphonyl)Amino)Butyl Methacrylate |
| Molecular Structure | ![]() |
| Molecular Formula | C15H16F13NO4S |
| Molecular Weight | 553.33 |
| CAS Registry Number | 67939-61-1 |
| EINECS | 267-844-1 |
| SMILES | C(N([S](=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C)CCCOC(=O)C(=C)C |
| InChI | 1S/C15H16F13NO4S/c1-8(2)9(30)33-7-5-4-6-29(3)34(31,32)15(27,28)13(22,23)11(18,19)10(16,17)12(20,21)14(24,25)26/h1,4-7H2,2-3H3 |
| InChIKey | KKCCHFWHAXJXIQ-UHFFFAOYSA-N |
| Density | 1.48g/cm3 (Cal.) |
|---|---|
| Boiling point | 370.211°C at 760 mmHg (Cal.) |
| Flash point | 177.698°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[Methyl[(Tridecafluorohexyl)Sulphonyl]Amino]Butyl Methacrylate |