|
CAS#: 6795-60-4 Product: Deprodone No suppilers available for the product. |
| Name | Deprodone |
|---|---|
| Synonyms | (8R,9S,10R,13S,14S,17R)-17-Hydroxy-13-Methyl-17-Vinyl-1,2,6,7,8,9,10,11,12,14,15,16-Dodecahydrocyclopenta[A]Phenanthren-3-One; 17-Hydroxy-17-Alpha-Vinyl-4-Estren-3-One; 17-Hydroxy-19-Nor-17-Alpha-Pregna-4,20-Dien-3-One |
| Molecular Structure | ![]() |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 |
| CAS Registry Number | 6795-60-4 |
| SMILES | [C@H]12[C@@]([C@@](C=C)(O)CC1)(CC[C@H]3[C@H]2CCC4=CC(=O)CC[C@H]34)C |
| InChI | 1S/C20H28O2/c1-3-20(22)11-9-18-17-6-4-13-12-14(21)5-7-15(13)16(17)8-10-19(18,20)2/h3,12,15-18,22H,1,4-11H2,2H3/t15-,16+,17+,18-,19-,20-/m0/s1 |
| InChIKey | VOJYZDFYEHKHAP-XGXHKTLJSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 444.0±45.0°C at 760 mmHg (Cal.) |
| Flash point | 189.2±21.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Deprodone |