|
CAS#: 67952-43-6 Product: Nickel Dichlorate No suppilers available for the product. |
| Name | Nickel Dichlorate |
|---|---|
| Synonyms | Nickelous Dichlorate; Chloric Acid, Nickel(2+) Salt; Nickel Chlorate |
| Molecular Structure | ![]() |
| Molecular Formula | Cl2NiO6 |
| Molecular Weight | 225.60 |
| CAS Registry Number | 67952-43-6 |
| EINECS | 267-897-0 |
| SMILES | [Cl]([O-])(=O)=O.O=[Cl]([O-])=O.[Ni++] |
| InChI | 1S/2ClHO3.Ni/c2*2-1(3)4;/h2*(H,2,3,4);/q;;+2/p-2 |
| InChIKey | RZLUIDROFNIMHF-UHFFFAOYSA-L |
| Market Analysis Reports |
| List of Reports Available for Nickel Dichlorate |