|
CAS#: 67969-97-5 Product: 4-(1,1-Dimethylethyl)Phenol, Formaldehyde, 4-Methylphenol Polymer No suppilers available for the product. |
| Name | 4-(1,1-Dimethylethyl)Phenol, Formaldehyde, 4-Methylphenol Polymer |
|---|---|
| Synonyms | 4-Tert-Butylphenol; Formaldehyde; P-Cresol; 4-Tert-Butylphenol; Methanal; 4-Methylphenol |
| Molecular Formula | C18H24O3 |
| Molecular Weight | 288.39 |
| CAS Registry Number | 67969-97-5 |
| SMILES | C1=CC(=CC=C1O)C(C)(C)C.O=C.C2=CC(=CC=C2O)C |
| InChI | 1S/C10H14O.C7H8O.CH2O/c1-10(2,3)8-4-6-9(11)7-5-8;1-6-2-4-7(8)5-3-6;1-2/h4-7,11H,1-3H3;2-5,8H,1H3;1H2 |
| InChIKey | XPHXFLBZIVXKIO-UHFFFAOYSA-N |
| Boiling point | 233.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 110.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(1,1-Dimethylethyl)Phenol, Formaldehyde, 4-Methylphenol Polymer |