|
CAS#: 68039-45-2 Product: 3a,4,5,6,7,7alpha-Hexahydro-4,7-Methano-1H-Inden-5-Yl Pivalate No suppilers available for the product. |
| Name | 3a,4,5,6,7,7alpha-Hexahydro-4,7-Methano-1H-Inden-5-Yl Pivalate |
|---|---|
| Synonyms | 3A,4,5,6,7,7A-Hexahydro-4,7-Methano-1H-Inden-5-Yl Pivalate; Propanoic Acid, 2,2-Dimethyl-, 3A,4,5,6,7,7A-Hexahydro-4,7-Methano-1H-Inden-5-Yl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 |
| CAS Registry Number | 68039-45-2 |
| EINECS | 268-261-5 |
| SMILES | CC(C(OC3C2C1C(CC=C1)C(C2)C3)=O)(C)C |
| InChI | 1S/C15H22O2/c1-15(2,3)14(16)17-13-8-9-7-12(13)11-6-4-5-10(9)11/h4,6,9-13H,5,7-8H2,1-3H3 |
| InChIKey | SARNDXMIYRKJOG-UHFFFAOYSA-N |
| Density | 1.066g/cm3 (Cal.) |
|---|---|
| Boiling point | 299.408°C at 760 mmHg (Cal.) |
| Flash point | 127.424°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3a,4,5,6,7,7alpha-Hexahydro-4,7-Methano-1H-Inden-5-Yl Pivalate |