|
CAS#: 68052-68-6 Product: Ethylammonium Perfluoro(13-Methyltetradecanoate) No suppilers available for the product. |
| Name | Ethylammonium Perfluoro(13-Methyltetradecanoate) |
|---|---|
| Synonyms | Ethylamine; 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,14,14,14-Hexacosafluoro-13-(Trifluoromethyl)Myristic Acid; Tetradecanoic Acid, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,14,14,14-Hexacosafluoro-13-(Trifluoromethyl)-, Compd. With Ethanamine (1:1) |
| Molecular Structure | ![]() |
| Molecular Formula | C17H8F29NO2 |
| Molecular Weight | 809.21 |
| CAS Registry Number | 68052-68-6 |
| EINECS | 268-331-5 |
| SMILES | O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F.C(N)C |
| InChI | 1S/C15HF29O2.C2H7N/c16-2(17,1(45)46)4(19,20)6(23,24)8(27,28)10(31,32)12(35,36)13(37,38)11(33,34)9(29,30)7(25,26)5(21,22)3(18,14(39,40)41)15(42,43)44;1-2-3/h(H,45,46);2-3H2,1H3 |
| InChIKey | VIZSCVXDHHKCBQ-UHFFFAOYSA-N |
| Boiling point | 283.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 125.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethylammonium Perfluoro(13-Methyltetradecanoate) |