|
CAS#: 680618-75-1 Product: 2-[(1E)-1-Propen-1-ylamino]-1,4-naphthoquinone No suppilers available for the product. |
| Name | 2-[(1E)-1-Propen-1-ylamino]-1,4-naphthoquinone |
|---|---|
| Synonyms | 1,4-NAPHTHALENEDIONE, 2-[(1E)-1-PROPENYLAMINO]- (9CI) |
| Molecular Structure | ![]() |
| Molecular Formula | C13H11NO2 |
| Molecular Weight | 213.23 |
| CAS Registry Number | 680618-75-1 |
| SMILES | C/C=C/NC1=CC(=O)c2ccccc2C1=O |
| InChI | 1S/C13H11NO2/c1-2-7-14-11-8-12(15)9-5-3-4-6-10(9)13(11)16/h2-8,14H,1H3/b7-2+ |
| InChIKey | PHHZHZJOYFFBKT-FARCUNLSSA-N |
| Density | 1.224g/cm3 (Cal.) |
|---|---|
| Boiling point | 366.832°C at 760 mmHg (Cal.) |
| Flash point | 152.325°C (Cal.) |
| Refractive index | 1.612 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[(1E)-1-Propen-1-ylamino]-1,4-naphthoquinone |